C30H39F3O5 — CID 25158638
[(2E)-2-[(4aR,5R,8aS)-4a-methyl-8-methylidene-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ylidene]propyl] 2,2-dimethylpropanoate (PubChem CID 25158638) has the molecular formula C30H39F3O5 and a molecular weight of 536.63 g/mol. Its IUPAC name is [(2E)-2-[(4aR,5R,8aS)-4a-methyl-8-methylidene-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ylidene]propyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E)-2-[(4aR,5R,8aS)-4a-methyl-8-methylidene-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ylidene]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 25158638 |
| Molecular Formula | C30H39F3O5 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | [(2E)-2-[(4aR,5R,8aS)-4a-methyl-8-methylidene-5-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxy-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ylidene]propyl] 2,2-dimethylpropanoate |
| SMILES | C=C1CC[C@@H](OC(=O)[C@](OC)(c2ccccc2)C(F)(F)F)[C@]2(C)CC/C(=C(/C)COC(=O)C(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C30H39F3O5/c1-19-13-14-24(38-26(35)29(36-7,30(31,32)33)22-11-9-8-10-12-22)28(6)16-15-21(17-23(19)28)20(2)18-37-25(34)27(3,4)5/h8-12,23-24H,1,13-18H2,2-7H3/b21-20+/t23-,24+,28+,29+/m0/s1 |
| InChIKey | MOHZHBORJSIHNN-CSANXUCHSA-N |
| XLogP | 7.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|