C30H37F3O5 — CID 46209790
[(1R)-2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 46209790) has the molecular formula C30H37F3O5 and a molecular weight of 534.62 g/mol. Its IUPAC name is [(1R)-2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R)-2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 46209790 |
| Molecular Formula | C30H37F3O5 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | [(1R)-2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)C1=CCOC1=O |
| InChI | InChI=1S/C30H37F3O5/c1-19-12-13-24-27(2,3)15-9-16-28(24,4)22(19)18-23(21-14-17-37-25(21)34)38-26(35)29(36-5,30(31,32)33)20-10-7-6-8-11-20/h6-8,10-11,14,22-24H,1,9,12-13,15-18H2,2-5H3/t22-,23+,24-,28+,29-/m0/s1 |
| InChIKey | HZHBOOLZYSEJMM-HNRKFLNASA-N |
| XLogP | 6.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|