C30H43F3O6 — CID 46939597
methyl (2R,3R,6R)-8-(2,2-dimethyl-6-methylidenecyclohexyl)-6-hydroxy-2,6-dimethyl-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyoctanoate (PubChem CID 46939597) has the molecular formula C30H43F3O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is methyl (2R,3R,6R)-8-(2,2-dimethyl-6-methylidenecyclohexyl)-6-hydroxy-2,6-dimethyl-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyoctanoate.
| Compound Name | methyl (2R,3R,6R)-8-(2,2-dimethyl-6-methylidenecyclohexyl)-6-hydroxy-2,6-dimethyl-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyoctanoate |
|---|---|
| PubChem CID | 46939597 |
| Molecular Formula | C30H43F3O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | methyl (2R,3R,6R)-8-(2,2-dimethyl-6-methylidenecyclohexyl)-6-hydroxy-2,6-dimethyl-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxyoctanoate |
| SMILES | C=C1CCCC(C)(C)C1CC[C@@](C)(O)CC[C@@H](OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C30H43F3O6/c1-20-12-11-17-27(3,4)23(20)15-18-28(5,36)19-16-24(21(2)25(34)37-6)39-26(35)29(38-7,30(31,32)33)22-13-9-8-10-14-22/h8-10,13-14,21,23-24,36H,1,11-12,15-19H2,2-7H3/t21-,23?,24-,28-,29-/m1/s1 |
| InChIKey | LQXPNUDJOUZXCK-RVAPTZJLSA-N |
| XLogP | 6.51 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|