C26H35NO4 — CID 59070366
4-[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-anilinoethyl]-2H-furan-5-one (PubChem CID 59070366) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is 4-[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-anilinoethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-anilinoethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 59070366 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 4-[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-anilinoethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2[C@](C)(CO)C(O)CC[C@]2(C)[C@H]1CC(Nc1ccccc1)C1=CCOC1=O |
| InChI | InChI=1S/C26H35NO4/c1-17-9-10-22-25(2,13-11-23(29)26(22,3)16-28)20(17)15-21(19-12-14-31-24(19)30)27-18-7-5-4-6-8-18/h4-8,12,20-23,27-29H,1,9-11,13-16H2,2-3H3/t20-,21?,22?,23?,25+,26-/m0/s1 |
| InChIKey | UBXRBJKNTNUXBE-KNSDLTJZSA-N |
| XLogP | 4.08 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|