C28H39NO6 — CID 20592887
4-[1-(3,4-dimethoxyanilino)-2-[6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 20592887) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is 4-[1-(3,4-dimethoxyanilino)-2-[6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[1-(3,4-dimethoxyanilino)-2-[6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 20592887 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 4-[1-(3,4-dimethoxyanilino)-2-[6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2C(C)(CO)C(O)CCC2(C)C1CC(Nc1ccc(OC)c(OC)c1)C1=CCOC1=O |
| InChI | InChI=1S/C28H39NO6/c1-17-6-9-24-27(2,12-10-25(31)28(24,3)16-30)20(17)15-21(19-11-13-35-26(19)32)29-18-7-8-22(33-4)23(14-18)34-5/h7-8,11,14,20-21,24-25,29-31H,1,6,9-10,12-13,15-16H2,2-5H3 |
| InChIKey | TYEKQIVOOLZODH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|