C27H36ClNO4 — CID 59741081
4-[2-[(5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-[(2-chlorophenyl)methylamino]ethyl]-2H-furan-5-one (PubChem CID 59741081) has the molecular formula C27H36ClNO4 and a molecular weight of 474.04 g/mol. Its IUPAC name is 4-[2-[(5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-[(2-chlorophenyl)methylamino]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-[(2-chlorophenyl)methylamino]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 59741081 |
| Molecular Formula | C27H36ClNO4 |
| Molecular Weight | 474.04 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 4-[2-[(5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-[(2-chlorophenyl)methylamino]ethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2[C@](C)(CC[C@@H](O)[C@@]2(C)CO)C1CC(NCc1ccccc1Cl)C1=CCOC1=O |
| InChI | InChI=1S/C27H36ClNO4/c1-17-8-9-23-26(2,12-10-24(31)27(23,3)16-30)20(17)14-22(19-11-13-33-25(19)32)29-15-18-6-4-5-7-21(18)28/h4-7,11,20,22-24,29-31H,1,8-10,12-16H2,2-3H3/t20?,22?,23?,24-,26-,27+/m1/s1 |
| InChIKey | SXRHSXKAJOTKGS-ITOBKQNVSA-N |
| XLogP | 4.41 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.04 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|