C26H33NO4S — CID 71721865
4-[(Z)-2-[(5R,6S,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2-aminophenyl)sulfanylethenyl]-2H-furan-5-one (PubChem CID 71721865) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is 4-[(Z)-2-[(5R,6S,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2-aminophenyl)sulfanylethenyl]-2H-furan-5-one.
| Compound Name | 4-[(Z)-2-[(5R,6S,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2-aminophenyl)sulfanylethenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 71721865 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 4-[(Z)-2-[(5R,6S,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(2-aminophenyl)sulfanylethenyl]-2H-furan-5-one |
| SMILES | C=C1CCC2[C@](C)(CC[C@H](O)[C@@]2(C)CO)C1/C=C(\Sc1ccccc1N)C1=CCOC1=O |
| InChI | InChI=1S/C26H33NO4S/c1-16-8-9-22-25(2,12-10-23(29)26(22,3)15-28)18(16)14-21(17-11-13-31-24(17)30)32-20-7-5-4-6-19(20)27/h4-7,11,14,18,22-23,28-29H,1,8-10,12-13,15,27H2,2-3H3/b21-14-/t18?,22?,23-,25+,26-/m0/s1 |
| InChIKey | YRQMTBWJTGZSII-SQGKDGJISA-N |
| XLogP | 4.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|