C24H37NO6 — CID 59070391
methyl 2-[[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]amino]propanoate (PubChem CID 59070391) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is methyl 2-[[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]amino]propanoate.
| Compound Name | methyl 2-[[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 59070391 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | methyl 2-[[2-[(1S,5R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]amino]propanoate |
| SMILES | C=C1CCC2[C@](C)(CO)C(O)CC[C@]2(C)[C@H]1CC(NC(C)C(=O)OC)C1=CCOC1=O |
| InChI | InChI=1S/C24H37NO6/c1-14-6-7-19-23(3,10-8-20(27)24(19,4)13-26)17(14)12-18(16-9-11-31-22(16)29)25-15(2)21(28)30-5/h9,15,17-20,25-27H,1,6-8,10-13H2,2-5H3/t15?,17-,18?,19?,20?,23+,24-/m0/s1 |
| InChIKey | GVUPYIMFPIWVNK-BTZRUDRISA-N |
| XLogP | 2.12 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|