C38H47NO6 — CID 59070359
methyl 2-[[2-[(6aR,7S,10bR)-3,6a,10b-trimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]amino]-3-phenylpropanoate (PubChem CID 59070359) has the molecular formula C38H47NO6 and a molecular weight of 613.80 g/mol. Its IUPAC name is methyl 2-[[2-[(6aR,7S,10bR)-3,6a,10b-trimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-[(6aR,7S,10bR)-3,6a,10b-trimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 59070359 |
| Molecular Formula | C38H47NO6 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | methyl 2-[[2-[(6aR,7S,10bR)-3,6a,10b-trimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-(5-oxo-2H-furan-4-yl)ethyl]amino]-3-phenylpropanoate |
| SMILES | C=C1CCC2[C@]3(C)COC(C)(c4ccccc4)OC3CC[C@]2(C)[C@H]1CC(NC(Cc1ccccc1)C(=O)OC)C1=CCOC1=O |
| InChI | InChI=1S/C38H47NO6/c1-25-16-17-32-36(2,20-18-33-37(32,3)24-44-38(4,45-33)27-14-10-7-11-15-27)29(25)23-30(28-19-21-43-34(28)40)39-31(35(41)42-5)22-26-12-8-6-9-13-26/h6-15,19,29-33,39H,1,16-18,20-24H2,2-5H3/t29-,30?,31?,32?,33?,36+,37-,38?/m0/s1 |
| InChIKey | XDWNYAFDOQVIIS-UFJWEWSDSA-N |
| XLogP | 6.28 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|