C32H43NO5 — CID 40818757
methyl (1S,4aR,5S,8aR)-5-[2-[2-[[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 40818757) has the molecular formula C32H43NO5 and a molecular weight of 521.70 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aR)-5-[2-[2-[[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aR)-5-[2-[2-[[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 40818757 |
| Molecular Formula | C32H43NO5 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | methyl (1S,4aR,5S,8aR)-5-[2-[2-[[[(2R)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CCc1ccoc1CN[C@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C32H43NO5/c1-22-12-15-28-31(2,17-9-18-32(28,3)30(35)37-5)25(22)14-13-24-16-19-38-27(24)21-33-26(29(34)36-4)20-23-10-7-6-8-11-23/h6-8,10-11,16,19,25-26,28,33H,1,9,12-15,17-18,20-21H2,2-5H3/t25-,26+,28+,31+,32-/m0/s1 |
| InChIKey | VBZABTLPKKERQO-XRFXZYFTSA-N |
| XLogP | 6.04 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|