C30H38O5 — CID 3717643
methyl 1,4a-dimethyl-5-[2-[2-[(4-methylbenzoyl)oxymethyl]furan-3-yl]ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 3717643) has the molecular formula C30H38O5 and a molecular weight of 478.63 g/mol. Its IUPAC name is methyl 1,4a-dimethyl-5-[2-[2-[(4-methylbenzoyl)oxymethyl]furan-3-yl]ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl 1,4a-dimethyl-5-[2-[2-[(4-methylbenzoyl)oxymethyl]furan-3-yl]ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 3717643 |
| Molecular Formula | C30H38O5 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | methyl 1,4a-dimethyl-5-[2-[2-[(4-methylbenzoyl)oxymethyl]furan-3-yl]ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CCC2C(C)(C(=O)OC)CCCC2(C)C1CCc1ccoc1COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H38O5/c1-20-7-10-23(11-8-20)27(31)35-19-25-22(15-18-34-25)12-13-24-21(2)9-14-26-29(24,3)16-6-17-30(26,4)28(32)33-5/h7-8,10-11,15,18,24,26H,2,6,9,12-14,16-17,19H2,1,3-5H3 |
| InChIKey | PIGONDGFOLZMGF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|