C26H39NO7 — CID 52993814
methyl (1S,4aR,5S)-5-[2-[2-[(dimethylamino)methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate;oxalic acid (PubChem CID 52993814) has the molecular formula C26H39NO7 and a molecular weight of 477.60 g/mol. Its IUPAC name is methyl (1S,4aR,5S)-5-[2-[2-[(dimethylamino)methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate;oxalic acid.
| Compound Name | methyl (1S,4aR,5S)-5-[2-[2-[(dimethylamino)methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 52993814 |
| Molecular Formula | C26H39NO7 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | methyl (1S,4aR,5S)-5-[2-[2-[(dimethylamino)methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate;oxalic acid |
| SMILES | C=C1CCC2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CCc1ccoc1CN(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H37NO3.C2H2O4/c1-17-8-11-21-23(2,13-7-14-24(21,3)22(26)27-6)19(17)10-9-18-12-15-28-20(18)16-25(4)5;3-1(4)2(5)6/h12,15,19,21H,1,7-11,13-14,16H2,2-6H3;(H,3,4)(H,5,6)/t19-,21?,23+,24-;/m0./s1 |
| InChIKey | LFOVHRTVJZEBIK-CGLQPVKHSA-N |
| XLogP | 4.38 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|