C26H40NO4+ — CID 11874739
methyl (1S,4aR,5S,8aS)-1,4a-dimethyl-6-methylidene-5-[2-[2-(morpholin-4-ium-4-ylmethyl)furan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 11874739) has the molecular formula C26H40NO4+ and a molecular weight of 430.61 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aS)-1,4a-dimethyl-6-methylidene-5-[2-[2-(morpholin-4-ium-4-ylmethyl)furan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aS)-1,4a-dimethyl-6-methylidene-5-[2-[2-(morpholin-4-ium-4-ylmethyl)furan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11874739 |
| Molecular Formula | C26H40NO4+ |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | methyl (1S,4aR,5S,8aS)-1,4a-dimethyl-6-methylidene-5-[2-[2-(morpholin-4-ium-4-ylmethyl)furan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CCc1ccoc1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C26H39NO4/c1-19-6-9-23-25(2,11-5-12-26(23,3)24(28)29-4)21(19)8-7-20-10-15-31-22(20)18-27-13-16-30-17-14-27/h10,15,21,23H,1,5-9,11-14,16-18H2,2-4H3/p+1/t21-,23-,25+,26-/m0/s1 |
| InChIKey | NEHOOTOVVLNUDJ-CWMWJYQDSA-O |
| XLogP | 3.58 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|