C29H36O5 — CID 44656472
methyl (4aR,5S)-5-[2-[2-(benzoyloxymethyl)furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 44656472) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is methyl (4aR,5S)-5-[2-[2-(benzoyloxymethyl)furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (4aR,5S)-5-[2-[2-(benzoyloxymethyl)furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 44656472 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | methyl (4aR,5S)-5-[2-[2-(benzoyloxymethyl)furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CCC2C(C)(C(=O)OC)CCC[C@]2(C)[C@H]1CCc1ccoc1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H36O5/c1-20-11-14-25-28(2,16-8-17-29(25,3)27(31)32-4)23(20)13-12-21-15-18-33-24(21)19-34-26(30)22-9-6-5-7-10-22/h5-7,9-10,15,18,23,25H,1,8,11-14,16-17,19H2,2-4H3/t23-,25?,28+,29?/m0/s1 |
| InChIKey | NLWIDYSIBNZSQY-BMVVHMKZSA-N |
| XLogP | 6.52 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|