C31H41NO5 — CID 40872341
methyl (1S,4aR,5S,8aR)-5-[2-[2-[[(4-methoxybenzoyl)-methylamino]methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 40872341) has the molecular formula C31H41NO5 and a molecular weight of 507.67 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aR)-5-[2-[2-[[(4-methoxybenzoyl)-methylamino]methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aR)-5-[2-[2-[[(4-methoxybenzoyl)-methylamino]methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 40872341 |
| Molecular Formula | C31H41NO5 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | methyl (1S,4aR,5S,8aR)-5-[2-[2-[[(4-methoxybenzoyl)-methylamino]methyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CCc1ccoc1CN(C)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H41NO5/c1-21-8-15-27-30(2,17-7-18-31(27,3)29(34)36-6)25(21)14-11-22-16-19-37-26(22)20-32(4)28(33)23-9-12-24(35-5)13-10-23/h9-10,12-13,16,19,25,27H,1,7-8,11,14-15,17-18,20H2,2-6H3/t25-,27+,30+,31-/m0/s1 |
| InChIKey | MOVBUDQPVJFVRW-FJXGDJEOSA-N |
| XLogP | 6.44 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|