C24H35NO6 — CID 59741084
(4aR,6aS,10bR)-7-[2-(2-methoxyethylamino)-2-(5-oxo-2H-furan-4-yl)ethyl]-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-3-one (PubChem CID 59741084) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is (4aR,6aS,10bR)-7-[2-(2-methoxyethylamino)-2-(5-oxo-2H-furan-4-yl)ethyl]-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-3-one.
| Compound Name | (4aR,6aS,10bR)-7-[2-(2-methoxyethylamino)-2-(5-oxo-2H-furan-4-yl)ethyl]-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-3-one |
|---|---|
| PubChem CID | 59741084 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | (4aR,6aS,10bR)-7-[2-(2-methoxyethylamino)-2-(5-oxo-2H-furan-4-yl)ethyl]-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-3-one |
| SMILES | C=C1CCC2[C@@](C)(CC[C@H]3OC(=O)OC[C@@]23C)C1CC(NCCOC)C1=CCOC1=O |
| InChI | InChI=1S/C24H35NO6/c1-15-5-6-19-23(2,9-7-20-24(19,3)14-30-22(27)31-20)17(15)13-18(25-10-12-28-4)16-8-11-29-21(16)26/h8,17-20,25H,1,5-7,9-14H2,2-4H3/t17?,18?,19?,20-,23+,24+/m1/s1 |
| InChIKey | JIVDFHJJUVXUNC-KWJNIKROSA-N |
| XLogP | 3.39 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|