C30H43N3O6 — CID 10119714
[(1R,2R,4aR,5S)-2-acetyloxy-5-[2-(3-imidazol-1-ylpropylamino)-2-(5-oxo-2H-furan-4-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 10119714) has the molecular formula C30H43N3O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is [(1R,2R,4aR,5S)-2-acetyloxy-5-[2-(3-imidazol-1-ylpropylamino)-2-(5-oxo-2H-furan-4-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1R,2R,4aR,5S)-2-acetyloxy-5-[2-(3-imidazol-1-ylpropylamino)-2-(5-oxo-2H-furan-4-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10119714 |
| Molecular Formula | C30H43N3O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | [(1R,2R,4aR,5S)-2-acetyloxy-5-[2-(3-imidazol-1-ylpropylamino)-2-(5-oxo-2H-furan-4-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | C=C1CCC2[C@](C)(COC(C)=O)[C@H](OC(C)=O)CC[C@]2(C)[C@H]1CC(NCCCn1ccnc1)C1=CCOC1=O |
| InChI | InChI=1S/C30H43N3O6/c1-20-7-8-26-29(4,11-9-27(39-22(3)35)30(26,5)18-38-21(2)34)24(20)17-25(23-10-16-37-28(23)36)32-12-6-14-33-15-13-31-19-33/h10,13,15,19,24-27,32H,1,6-9,11-12,14,16-18H2,2-5H3/t24-,25?,26?,27+,29+,30-/m0/s1 |
| InChIKey | ADTXPYIXQFIIMC-VBAXJMGSSA-N |
| XLogP | 3.99 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|