C25H38O4S — CID 59070372
4-[2-[(4aR,6aR,7S,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-ethylsulfanylethyl]-2H-furan-5-one (PubChem CID 59070372) has the molecular formula C25H38O4S and a molecular weight of 434.64 g/mol. Its IUPAC name is 4-[2-[(4aR,6aR,7S,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-ethylsulfanylethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(4aR,6aR,7S,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-ethylsulfanylethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 59070372 |
| Molecular Formula | C25H38O4S |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 4-[2-[(4aR,6aR,7S,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-ethylsulfanylethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2[C@]3(C)COC(C)(C)O[C@@H]3CC[C@]2(C)[C@H]1CC(SCC)C1=CCOC1=O |
| InChI | InChI=1S/C25H38O4S/c1-7-30-19(17-11-13-27-22(17)26)14-18-16(2)8-9-20-24(18,5)12-10-21-25(20,6)15-28-23(3,4)29-21/h11,18-21H,2,7-10,12-15H2,1,3-6H3/t18-,19?,20?,21+,24+,25-/m0/s1 |
| InChIKey | BKQNCUURQNMGEP-BQTRFDDXSA-N |
| XLogP | 5.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|