C21H34O2 — CID 129182321
(4aR,6aS,7R,10bR)-7-ethyl-6a,10b-dimethyl-8-methylidenespiro[1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxine-3,1'-cyclopentane] (PubChem CID 129182321) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (4aR,6aS,7R,10bR)-7-ethyl-6a,10b-dimethyl-8-methylidenespiro[1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxine-3,1'-cyclopentane].
| Compound Name | (4aR,6aS,7R,10bR)-7-ethyl-6a,10b-dimethyl-8-methylidenespiro[1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxine-3,1'-cyclopentane] |
|---|---|
| PubChem CID | 129182321 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (4aR,6aS,7R,10bR)-7-ethyl-6a,10b-dimethyl-8-methylidenespiro[1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxine-3,1'-cyclopentane] |
| SMILES | C=C1CCC2[C@]3(C)COC4(CCCC4)O[C@@H]3CC[C@@]2(C)[C@@H]1CC |
| InChI | InChI=1S/C21H34O2/c1-5-16-15(2)8-9-17-19(16,3)13-10-18-20(17,4)14-22-21(23-18)11-6-7-12-21/h16-18H,2,5-14H2,1,3-4H3/t16-,17?,18-,19+,20+/m1/s1 |
| InChIKey | DSICCIZYEFFTKI-NWJVMNJYSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|