C20H32O3 — CID 122402662
1-[(4aR,6aS,7R,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]propan-2-one (PubChem CID 122402662) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 1-[(4aR,6aS,7R,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]propan-2-one.
| Compound Name | 1-[(4aR,6aS,7R,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]propan-2-one |
|---|---|
| PubChem CID | 122402662 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 1-[(4aR,6aS,7R,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]propan-2-one |
| SMILES | C=C1CCC2[C@]3(C)COC(C)(C)O[C@@H]3CC[C@@]2(C)[C@@H]1CC(C)=O |
| InChI | InChI=1S/C20H32O3/c1-13-7-8-16-19(5,15(13)11-14(2)21)10-9-17-20(16,6)12-22-18(3,4)23-17/h15-17H,1,7-12H2,2-6H3/t15-,16?,17-,19+,20+/m1/s1 |
| InChIKey | TWDAIJRWQGPLLD-OYOGLQNUSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|