C23H36O2 — CID 162929953
(4aR,4bS,8aS,10aS)-1,1,8a-trimethyl-7-methylidene-8-(3-oxobutyl)-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-4a-carbaldehyde (PubChem CID 162929953) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (4aR,4bS,8aS,10aS)-1,1,8a-trimethyl-7-methylidene-8-(3-oxobutyl)-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-4a-carbaldehyde.
| Compound Name | (4aR,4bS,8aS,10aS)-1,1,8a-trimethyl-7-methylidene-8-(3-oxobutyl)-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-4a-carbaldehyde |
|---|---|
| PubChem CID | 162929953 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (4aR,4bS,8aS,10aS)-1,1,8a-trimethyl-7-methylidene-8-(3-oxobutyl)-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-4a-carbaldehyde |
| SMILES | C=C1CC[C@@H]2[C@@]3(C=O)CCCC(C)(C)[C@@H]3CC[C@@]2(C)C1CCC(C)=O |
| InChI | InChI=1S/C23H36O2/c1-16-7-10-20-22(5,18(16)9-8-17(2)25)14-11-19-21(3,4)12-6-13-23(19,20)15-24/h15,18-20H,1,6-14H2,2-5H3/t18?,19-,20-,22-,23+/m0/s1 |
| InChIKey | KSJHEGGDTGLBND-GPUKDSNQSA-N |
| XLogP | 5.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|