C20H36OP2 — CID 134235566
[(E)-5-[(1R,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enoxy]-phosphanylphosphane (PubChem CID 134235566) has the molecular formula C20H36OP2 and a molecular weight of 354.46 g/mol. Its IUPAC name is [(E)-5-[(1R,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enoxy]-phosphanylphosphane.
| Compound Name | [(E)-5-[(1R,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enoxy]-phosphanylphosphane |
|---|---|
| PubChem CID | 134235566 |
| Molecular Formula | C20H36OP2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [(E)-5-[(1R,8aR)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enoxy]-phosphanylphosphane |
| SMILES | C=C1CCC2C(C)(C)CCC[C@@]2(C)[C@@H]1CC/C(C)=C/COPP |
| InChI | InChI=1S/C20H36OP2/c1-15(11-14-21-23-22)7-9-17-16(2)8-10-18-19(3,4)12-6-13-20(17,18)5/h11,17-18,23H,2,6-10,12-14,22H2,1,3-5H3/b15-11+/t17-,18?,20+/m1/s1 |
| InChIKey | GNSWRYDRRQKWOY-HNFXNKIISA-N |
| XLogP | 6.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|