C25H42N2S — CID 145462776
N-[(E)-[(Z)-8-[(8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-6-methyloct-5-en-2-ylidene]amino]ethanethioamide (PubChem CID 145462776) has the molecular formula C25H42N2S and a molecular weight of 402.69 g/mol. Its IUPAC name is N-[(E)-[(Z)-8-[(8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-6-methyloct-5-en-2-ylidene]amino]ethanethioamide.
| Compound Name | N-[(E)-[(Z)-8-[(8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-6-methyloct-5-en-2-ylidene]amino]ethanethioamide |
|---|---|
| PubChem CID | 145462776 |
| Molecular Formula | C25H42N2S |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | N-[(E)-[(Z)-8-[(8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-6-methyloct-5-en-2-ylidene]amino]ethanethioamide |
| SMILES | C=C1CCC2C(C)(C)CCC[C@]2(C)C1CC/C(C)=C\CC/C(C)=N/NC(C)=S |
| InChI | InChI=1S/C25H42N2S/c1-18(10-8-11-20(3)26-27-21(4)28)12-14-22-19(2)13-15-23-24(5,6)16-9-17-25(22,23)7/h10,22-23H,2,8-9,11-17H2,1,3-7H3,(H,27,28)/b18-10-,26-20+/t22?,23?,25-/m1/s1 |
| InChIKey | SEUDRBGADVNZTK-JJEXLLQQSA-N |
| XLogP | 7.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|