C31H36O5S — CID 172990730
4-[2-[3-(furan-2-yl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one (PubChem CID 172990730) has the molecular formula C31H36O5S and a molecular weight of 520.69 g/mol. Its IUPAC name is 4-[2-[3-(furan-2-yl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[3-(furan-2-yl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 172990730 |
| Molecular Formula | C31H36O5S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 4-[2-[3-(furan-2-yl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2C3(C)COC(c4ccco4)OC3CCC2(C)C1CC(Sc1ccccc1)C1=CCOC1=O |
| InChI | InChI=1S/C31H36O5S/c1-20-11-12-26-30(2,15-13-27-31(26,3)19-35-29(36-27)24-10-7-16-33-24)23(20)18-25(22-14-17-34-28(22)32)37-21-8-5-4-6-9-21/h4-10,14,16,23,25-27,29H,1,11-13,15,17-19H2,2-3H3 |
| InChIKey | WXJQWIVNLFHEAJ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|