C20H30O7S — CID 101261606
(1R)-2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethanesulfonic acid (PubChem CID 101261606) has the molecular formula C20H30O7S and a molecular weight of 414.52 g/mol. Its IUPAC name is (1R)-2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethanesulfonic acid.
| Compound Name | (1R)-2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 101261606 |
| Molecular Formula | C20H30O7S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (1R)-2-[(1R,5R,6R,8aS)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-1-(5-oxo-2H-furan-4-yl)ethanesulfonic acid |
| SMILES | C=C1CCC2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1C[C@H](C1=CCOC1=O)S(=O)(=O)O |
| InChI | InChI=1S/C20H30O7S/c1-12-4-5-16-19(2,8-6-17(22)20(16,3)11-21)14(12)10-15(28(24,25)26)13-7-9-27-18(13)23/h7,14-17,21-22H,1,4-6,8-11H2,2-3H3,(H,24,25,26)/t14-,15-,16?,17-,19+,20+/m1/s1 |
| InChIKey | LCOXPNVKZBRGJS-RIQHVNDASA-N |
| XLogP | 1.86 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|