C24H29F3O6 — CID 24763083
[(E,2Z)-5-oxo-2-[(2S)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypropylidene]hex-3-enyl] 2,2-dimethylpropanoate (PubChem CID 24763083) has the molecular formula C24H29F3O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is [(E,2Z)-5-oxo-2-[(2S)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypropylidene]hex-3-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,2Z)-5-oxo-2-[(2S)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypropylidene]hex-3-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24763083 |
| Molecular Formula | C24H29F3O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [(E,2Z)-5-oxo-2-[(2S)-2-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypropylidene]hex-3-enyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@@H](C)/C=C(/C=C/C(C)=O)COC(=O)C(C)(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H29F3O6/c1-16(28)12-13-18(15-32-20(29)22(3,4)5)14-17(2)33-21(30)23(31-6,24(25,26)27)19-10-8-7-9-11-19/h7-14,17H,15H2,1-6H3/b13-12+,18-14-/t17-,23+/m0/s1 |
| InChIKey | VDQMSYHFJDCEJA-MONGQWGMSA-N |
| XLogP | 4.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|