C15H25BrO2 — CID 23424667
(3R,4R,7S,7aS)-7-bromo-3-[(1R)-1-hydroxy-2-methylprop-2-enyl]-4,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol (PubChem CID 23424667) has the molecular formula C15H25BrO2 and a molecular weight of 317.27 g/mol. Its IUPAC name is (3R,4R,7S,7aS)-7-bromo-3-[(1R)-1-hydroxy-2-methylprop-2-enyl]-4,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol.
| Compound Name | (3R,4R,7S,7aS)-7-bromo-3-[(1R)-1-hydroxy-2-methylprop-2-enyl]-4,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 23424667 |
| Molecular Formula | C15H25BrO2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (3R,4R,7S,7aS)-7-bromo-3-[(1R)-1-hydroxy-2-methylprop-2-enyl]-4,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol |
| SMILES | C=C(C)[C@H](O)C1CC[C@@]2(C)C1[C@](C)(O)CC[C@@H]2Br |
| InChI | InChI=1S/C15H25BrO2/c1-9(2)12(17)10-5-7-14(3)11(16)6-8-15(4,18)13(10)14/h10-13,17-18H,1,5-8H2,2-4H3/t10?,11-,12-,13?,14+,15+/m0/s1 |
| InChIKey | CLUMRIQLNFWQES-MWYNGGTGSA-N |
| XLogP | 3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|