C20H33BrO2 — CID 75182968
5-bromo-4,8-dimethyl-15-propan-2-yltetracyclo[10.2.1.01,10.04,9]pentadecane-8,13-diol (PubChem CID 75182968) has the molecular formula C20H33BrO2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 5-bromo-4,8-dimethyl-15-propan-2-yltetracyclo[10.2.1.01,10.04,9]pentadecane-8,13-diol.
| Compound Name | 5-bromo-4,8-dimethyl-15-propan-2-yltetracyclo[10.2.1.01,10.04,9]pentadecane-8,13-diol |
|---|---|
| PubChem CID | 75182968 |
| Molecular Formula | C20H33BrO2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 5-bromo-4,8-dimethyl-15-propan-2-yltetracyclo[10.2.1.01,10.04,9]pentadecane-8,13-diol |
| SMILES | CC(C)C1C2CC3C4C(C)(O)CCC(Br)C4(C)CCC31CC2O |
| InChI | InChI=1S/C20H33BrO2/c1-11(2)16-12-9-13-17-18(3,15(21)5-6-19(17,4)23)7-8-20(13,16)10-14(12)22/h11-17,22-23H,5-10H2,1-4H3 |
| InChIKey | DUDYIHSAQAOWKR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|