C15H26BrClO — CID 23425306
(1R,4S,4aS,8R,8aS)-4-bromo-8-chloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol (PubChem CID 23425306) has the molecular formula C15H26BrClO and a molecular weight of 337.73 g/mol. Its IUPAC name is (1R,4S,4aS,8R,8aS)-4-bromo-8-chloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol.
| Compound Name | (1R,4S,4aS,8R,8aS)-4-bromo-8-chloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 23425306 |
| Molecular Formula | C15H26BrClO |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (1R,4S,4aS,8R,8aS)-4-bromo-8-chloro-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ol |
| SMILES | CC(C)C1CC[C@]2(C)[C@@H](Br)CC[C@@](C)(O)[C@H]2[C@@H]1Cl |
| InChI | InChI=1S/C15H26BrClO/c1-9(2)10-5-7-14(3)11(16)6-8-15(4,18)13(14)12(10)17/h9-13,18H,5-8H2,1-4H3/t10?,11-,12+,13-,14+,15+/m0/s1 |
| InChIKey | SEHJXVSWIARHOZ-JKMBVOABSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|