C12H21BrO2 — CID 23247389
(3S,3aS,4R,7S,7aS)-7-bromo-3-(hydroxymethyl)-4,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol (PubChem CID 23247389) has the molecular formula C12H21BrO2 and a molecular weight of 277.20 g/mol. Its IUPAC name is (3S,3aS,4R,7S,7aS)-7-bromo-3-(hydroxymethyl)-4,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol.
| Compound Name | (3S,3aS,4R,7S,7aS)-7-bromo-3-(hydroxymethyl)-4,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 23247389 |
| Molecular Formula | C12H21BrO2 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (3S,3aS,4R,7S,7aS)-7-bromo-3-(hydroxymethyl)-4,7a-dimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol |
| SMILES | C[C@]12CC[C@H](CO)[C@@H]1[C@](C)(O)CC[C@@H]2Br |
| InChI | InChI=1S/C12H21BrO2/c1-11-5-3-8(7-14)10(11)12(2,15)6-4-9(11)13/h8-10,14-15H,3-7H2,1-2H3/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | CBUFGDQCEKAWAF-YBXAARCKSA-N |
| XLogP | 2.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|