C20H35BrO2 — CID 162908153
(1S,2R,4aS,6S,8aS)-6-bromo-1-[(E)-5-hydroxy-3-methylpent-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 162908153) has the molecular formula C20H35BrO2 and a molecular weight of 387.40 g/mol. Its IUPAC name is (1S,2R,4aS,6S,8aS)-6-bromo-1-[(E)-5-hydroxy-3-methylpent-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1S,2R,4aS,6S,8aS)-6-bromo-1-[(E)-5-hydroxy-3-methylpent-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 162908153 |
| Molecular Formula | C20H35BrO2 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (1S,2R,4aS,6S,8aS)-6-bromo-1-[(E)-5-hydroxy-3-methylpent-3-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | C/C(=C\CO)CC[C@H]1[C@@]2(C)CC[C@H](Br)C(C)(C)[C@H]2CC[C@@]1(C)O |
| InChI | InChI=1S/C20H35BrO2/c1-14(10-13-22)6-7-16-19(4)11-9-17(21)18(2,3)15(19)8-12-20(16,5)23/h10,15-17,22-23H,6-9,11-13H2,1-5H3/b14-10+/t15-,16+,17+,19+,20-/m1/s1 |
| InChIKey | VUFPGDSZNJURQC-ZDDZEKOJSA-N |
| XLogP | 5.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|