C15H25BrO — CID 163005938
(3R,3aS,4R,7S,7aS)-7-bromo-4,7a-dimethyl-3-(2-methylprop-1-enyl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol (PubChem CID 163005938) has the molecular formula C15H25BrO and a molecular weight of 301.27 g/mol. Its IUPAC name is (3R,3aS,4R,7S,7aS)-7-bromo-4,7a-dimethyl-3-(2-methylprop-1-enyl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol.
| Compound Name | (3R,3aS,4R,7S,7aS)-7-bromo-4,7a-dimethyl-3-(2-methylprop-1-enyl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 163005938 |
| Molecular Formula | C15H25BrO |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (3R,3aS,4R,7S,7aS)-7-bromo-4,7a-dimethyl-3-(2-methylprop-1-enyl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ol |
| SMILES | CC(C)=C[C@H]1CC[C@]2(C)[C@@H](Br)CC[C@@](C)(O)[C@@H]12 |
| InChI | InChI=1S/C15H25BrO/c1-10(2)9-11-5-7-14(3)12(16)6-8-15(4,17)13(11)14/h9,11-13,17H,5-8H2,1-4H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | NEJWBGSUEYGAGE-GZBLMMOJSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|