C12H20O — CID 6711372
(2S,3R,6R)-3,6-dimethyltricyclo[5.3.0.02,6]decan-3-ol (PubChem CID 6711372) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (2S,3R,6R)-3,6-dimethyltricyclo[5.3.0.02,6]decan-3-ol.
| Compound Name | (2S,3R,6R)-3,6-dimethyltricyclo[5.3.0.02,6]decan-3-ol |
|---|---|
| PubChem CID | 6711372 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2S,3R,6R)-3,6-dimethyltricyclo[5.3.0.02,6]decan-3-ol |
| SMILES | C[C@@]1(O)CC[C@]2(C)C3CCCC3[C@H]12 |
| InChI | InChI=1S/C12H20O/c1-11-6-7-12(2,13)10(11)8-4-3-5-9(8)11/h8-10,13H,3-7H2,1-2H3/t8?,9?,10-,11+,12+/m0/s1 |
| InChIKey | FQXBWZZZRBCNIJ-JEDMMJBGSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |