C11H19ClO — CID 101254788
(1R,4S,4aR,8aR)-4-chloro-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ol (PubChem CID 101254788) has the molecular formula C11H19ClO and a molecular weight of 202.72 g/mol. Its IUPAC name is (1R,4S,4aR,8aR)-4-chloro-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ol.
| Compound Name | (1R,4S,4aR,8aR)-4-chloro-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 101254788 |
| Molecular Formula | C11H19ClO |
| Molecular Weight | 202.72 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (1R,4S,4aR,8aR)-4-chloro-1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ol |
| SMILES | C[C@@]1(O)CC[C@H](Cl)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C11H19ClO/c1-11(13)7-6-10(12)8-4-2-3-5-9(8)11/h8-10,13H,2-7H2,1H3/t8-,9-,10+,11-/m1/s1 |
| InChIKey | BKWOEWIHBXFCPI-CHWFTXMASA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|