C10H19NO — CID 130792375
(4aS,5R,8aS)-5-methyl-2,3,4,4a,6,7,8,8a-octahydro-1H-quinolin-5-ol (PubChem CID 130792375) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (4aS,5R,8aS)-5-methyl-2,3,4,4a,6,7,8,8a-octahydro-1H-quinolin-5-ol.
| Compound Name | (4aS,5R,8aS)-5-methyl-2,3,4,4a,6,7,8,8a-octahydro-1H-quinolin-5-ol |
|---|---|
| PubChem CID | 130792375 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (4aS,5R,8aS)-5-methyl-2,3,4,4a,6,7,8,8a-octahydro-1H-quinolin-5-ol |
| SMILES | C[C@@]1(O)CCC[C@@H]2NCCC[C@@H]21 |
| InChI | InChI=1S/C10H19NO/c1-10(12)6-2-5-9-8(10)4-3-7-11-9/h8-9,11-12H,2-7H2,1H3/t8-,9-,10+/m0/s1 |
| InChIKey | POQUFKHJAQJBJL-LPEHRKFASA-N |
| XLogP | 1.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |