C8H17NO6P2 — CID 15234319
(5-phosphono-1,2,3,4,4a,6,7,7a-octahydrocyclopenta[b]pyridin-5-yl)phosphonic acid (PubChem CID 15234319) has the molecular formula C8H17NO6P2 and a molecular weight of 285.17 g/mol. Its IUPAC name is (5-phosphono-1,2,3,4,4a,6,7,7a-octahydrocyclopenta[b]pyridin-5-yl)phosphonic acid.
| Compound Name | (5-phosphono-1,2,3,4,4a,6,7,7a-octahydrocyclopenta[b]pyridin-5-yl)phosphonic acid |
|---|---|
| PubChem CID | 15234319 |
| Molecular Formula | C8H17NO6P2 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (5-phosphono-1,2,3,4,4a,6,7,7a-octahydrocyclopenta[b]pyridin-5-yl)phosphonic acid |
| SMILES | O=P(O)(O)C1(P(=O)(O)O)CCC2NCCCC21 |
| InChI | InChI=1S/C8H17NO6P2/c10-16(11,12)8(17(13,14)15)4-3-7-6(8)2-1-5-9-7/h6-7,9H,1-5H2,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | MGKRHZAXEDZCTD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|