C14H25ClO — CID 114623939
3-(2-chlorocyclohexyl)-2,2,5,5-tetramethyloxolane (PubChem CID 114623939) has the molecular formula C14H25ClO and a molecular weight of 244.81 g/mol. Its IUPAC name is 3-(2-chlorocyclohexyl)-2,2,5,5-tetramethyloxolane.
| Compound Name | 3-(2-chlorocyclohexyl)-2,2,5,5-tetramethyloxolane |
|---|---|
| PubChem CID | 114623939 |
| Molecular Formula | C14H25ClO |
| Molecular Weight | 244.81 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3-(2-chlorocyclohexyl)-2,2,5,5-tetramethyloxolane |
| SMILES | CC1(C)CC(C2CCCCC2Cl)C(C)(C)O1 |
| InChI | InChI=1S/C14H25ClO/c1-13(2)9-11(14(3,4)16-13)10-7-5-6-8-12(10)15/h10-12H,5-9H2,1-4H3 |
| InChIKey | KINNWUIEWUMWCY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|