C6H11ClO — CID 131071734
trans-(1R,2S)-2-chloro-1-methylcyclopentan-1-ol (PubChem CID 131071734) has the molecular formula C6H11ClO and a molecular weight of 134.61 g/mol. Its IUPAC name is trans-(1R,2S)-2-chloro-1-methylcyclopentan-1-ol.
| Compound Name | trans-(1R,2S)-2-chloro-1-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 131071734 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | trans-(1R,2S)-2-chloro-1-methylcyclopentan-1-ol |
| SMILES | C[C@@]1(O)CCC[C@@H]1Cl |
| InChI | InChI=1S/C6H11ClO/c1-6(8)4-2-3-5(6)7/h5,8H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | QEMBIVBEKXXUDH-NTSWFWBYSA-N |
| XLogP | 1.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|