C6H12Cl2N2O — CID 57325300
trans-(1R,2S)-1,2-diamino-2,3-dichlorocyclohexan-1-ol (PubChem CID 57325300) has the molecular formula C6H12Cl2N2O and a molecular weight of 199.08 g/mol. Its IUPAC name is trans-(1R,2S)-1,2-diamino-2,3-dichlorocyclohexan-1-ol.
| Compound Name | trans-(1R,2S)-1,2-diamino-2,3-dichlorocyclohexan-1-ol |
|---|---|
| PubChem CID | 57325300 |
| Molecular Formula | C6H12Cl2N2O |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | trans-(1R,2S)-1,2-diamino-2,3-dichlorocyclohexan-1-ol |
| SMILES | N[C@@]1(O)CCCC(Cl)[C@@]1(N)Cl |
| InChI | InChI=1S/C6H12Cl2N2O/c7-4-2-1-3-5(9,11)6(4,8)10/h4,11H,1-3,9-10H2/t4?,5-,6+/m1/s1 |
| InChIKey | WWJPREIPRPEDSE-UVCATTPVSA-N |
| XLogP | 0.32 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|