C6H8Cl4 — CID 91753297
(2S,3R)-1,1,2,3-tetrachlorocyclohexane (PubChem CID 91753297) has the molecular formula C6H8Cl4 and a molecular weight of 221.94 g/mol. Its IUPAC name is (2S,3R)-1,1,2,3-tetrachlorocyclohexane.
| Compound Name | (2S,3R)-1,1,2,3-tetrachlorocyclohexane |
|---|---|
| PubChem CID | 91753297 |
| Molecular Formula | C6H8Cl4 |
| Molecular Weight | 221.94 g/mol |
| Exact Mass | 219.94 |
| IUPAC Name | (2S,3R)-1,1,2,3-tetrachlorocyclohexane |
| SMILES | Cl[C@@H]1CCCC(Cl)(Cl)[C@H]1Cl |
| InChI | InChI=1S/C6H8Cl4/c7-4-2-1-3-6(9,10)5(4)8/h4-5H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | DAPOKGIHMOAVTF-UHNVWZDZSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.94 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|