About 3-chlorospiro[3.4]octane
3-chlorospiro[3.4]octane (PubChem CID 141290202) has the molecular formula C8H13Cl
and a molecular weight of 144.64 g/mol. Its IUPAC name is 3-chlorospiro[3.4]octane.
Molecular Properties
| Compound Name | 3-chlorospiro[3.4]octane |
| PubChem CID | 141290202 |
| Molecular Formula | C8H13Cl |
| Molecular Weight | 144.64 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 3-chlorospiro[3.4]octane |
| SMILES | ClC1CCC12CCCC2 |
| InChI | InChI=1S/C8H13Cl/c9-7-3-6-8(7)4-1-2-5-8/h7H,1-6H2 |
| InChIKey | CZROAMKRVKNUOL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorospiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorospiro[3.4]octane?
The IUPAC name of 3-chlorospiro[3.4]octane (CID 141290202) is 3-chlorospiro[3.4]octane.
What is the SMILES notation for 3-chlorospiro[3.4]octane?
The canonical SMILES for 3-chlorospiro[3.4]octane is ClC1CCC12CCCC2.
What is the InChIKey of 3-chlorospiro[3.4]octane?
The InChIKey is CZROAMKRVKNUOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl/c9-7-3-6-8(7)4-1-2-5-8/h7H,1-6H2.
What are the key properties of 3-chlorospiro[3.4]octane?
3-chlorospiro[3.4]octane has a molecular weight of 144.64 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorospiro[3.4]octane is sourced from PubChem (CID 141290202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).