C6H11BrClN — CID 173103835
trans-(1R,2S)-1-bromo-2-chlorocyclohexan-1-amine (PubChem CID 173103835) has the molecular formula C6H11BrClN and a molecular weight of 212.52 g/mol. Its IUPAC name is trans-(1R,2S)-1-bromo-2-chlorocyclohexan-1-amine.
| Compound Name | trans-(1R,2S)-1-bromo-2-chlorocyclohexan-1-amine |
|---|---|
| PubChem CID | 173103835 |
| Molecular Formula | C6H11BrClN |
| Molecular Weight | 212.52 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | trans-(1R,2S)-1-bromo-2-chlorocyclohexan-1-amine |
| SMILES | N[C@@]1(Br)CCCC[C@@H]1Cl |
| InChI | InChI=1S/C6H11BrClN/c7-6(9)4-2-1-3-5(6)8/h5H,1-4,9H2/t5-,6-/m0/s1 |
| InChIKey | JRHUELUFEIDRRQ-WDSKDSINSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|