About 5-iodospiro[5.5]undecane
5-iodospiro[5.5]undecane (PubChem CID 164989917) has the molecular formula C11H19I
and a molecular weight of 278.18 g/mol. Its IUPAC name is 5-iodospiro[5.5]undecane.
Molecular Properties
| Compound Name | 5-iodospiro[5.5]undecane |
| PubChem CID | 164989917 |
| Molecular Formula | C11H19I |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 5-iodospiro[5.5]undecane |
| SMILES | IC1CCCCC12CCCCC2 |
| InChI | InChI=1S/C11H19I/c12-10-6-2-5-9-11(10)7-3-1-4-8-11/h10H,1-9H2 |
| InChIKey | GRYSSUGSWJTNGS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodospiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodospiro[5.5]undecane?
The IUPAC name of 5-iodospiro[5.5]undecane (CID 164989917) is 5-iodospiro[5.5]undecane.
What is the SMILES notation for 5-iodospiro[5.5]undecane?
The canonical SMILES for 5-iodospiro[5.5]undecane is IC1CCCCC12CCCCC2.
What is the InChIKey of 5-iodospiro[5.5]undecane?
The InChIKey is GRYSSUGSWJTNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19I/c12-10-6-2-5-9-11(10)7-3-1-4-8-11/h10H,1-9H2.
What are the key properties of 5-iodospiro[5.5]undecane?
5-iodospiro[5.5]undecane has a molecular weight of 278.18 g/mol, XLogP of 4.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodospiro[5.5]undecane is sourced from PubChem (CID 164989917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).