About 3-methylspiro[3.5]nonane
3-methylspiro[3.5]nonane (PubChem CID 57473010) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is 3-methylspiro[3.5]nonane.
Molecular Properties
| Compound Name | 3-methylspiro[3.5]nonane |
| PubChem CID | 57473010 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 3-methylspiro[3.5]nonane |
| SMILES | CC1CCC12CCCCC2 |
| InChI | InChI=1S/C10H18/c1-9-5-8-10(9)6-3-2-4-7-10/h9H,2-8H2,1H3 |
| InChIKey | JWDUXXAVFCHYNL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methylspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylspiro[3.5]nonane?
The IUPAC name of 3-methylspiro[3.5]nonane (CID 57473010) is 3-methylspiro[3.5]nonane.
What is the SMILES notation for 3-methylspiro[3.5]nonane?
The canonical SMILES for 3-methylspiro[3.5]nonane is CC1CCC12CCCCC2.
What is the InChIKey of 3-methylspiro[3.5]nonane?
The InChIKey is JWDUXXAVFCHYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18/c1-9-5-8-10(9)6-3-2-4-7-10/h9H,2-8H2,1H3.
What are the key properties of 3-methylspiro[3.5]nonane?
3-methylspiro[3.5]nonane has a molecular weight of 138.25 g/mol, XLogP of 3.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylspiro[3.5]nonane is sourced from PubChem (CID 57473010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).