C11H23N — CID 169125292
(5S)-2,5-dimethyl-2-azaspiro[3.4]octane;ethane (PubChem CID 169125292) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is (5S)-2,5-dimethyl-2-azaspiro[3.4]octane;ethane.
| Compound Name | (5S)-2,5-dimethyl-2-azaspiro[3.4]octane;ethane |
|---|---|
| PubChem CID | 169125292 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (5S)-2,5-dimethyl-2-azaspiro[3.4]octane;ethane |
| SMILES | CC.C[C@H]1CCCC12CN(C)C2 |
| InChI | InChI=1S/C9H17N.C2H6/c1-8-4-3-5-9(8)6-10(2)7-9;1-2/h8H,3-7H2,1-2H3;1-2H3/t8-;/m0./s1 |
| InChIKey | BCIMDFNIBITQPP-QRPNPIFTSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |