C11H20O2 — CID 163558488
8-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1,4a-diol (PubChem CID 163558488) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 8-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1,4a-diol.
| Compound Name | 8-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1,4a-diol |
|---|---|
| PubChem CID | 163558488 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 8-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1,4a-diol |
| SMILES | CC1CCCC2(O)CCCC(O)C12 |
| InChI | InChI=1S/C11H20O2/c1-8-4-2-6-11(13)7-3-5-9(12)10(8)11/h8-10,12-13H,2-7H2,1H3 |
| InChIKey | FPEJWRCJXYHKCO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |