C7H9ClO — CID 131165760
cis-(1S,2S)-2-chloro-1-ethynylcyclopentan-1-ol (PubChem CID 131165760) has the molecular formula C7H9ClO and a molecular weight of 144.60 g/mol. Its IUPAC name is cis-(1S,2S)-2-chloro-1-ethynylcyclopentan-1-ol.
| Compound Name | cis-(1S,2S)-2-chloro-1-ethynylcyclopentan-1-ol |
|---|---|
| PubChem CID | 131165760 |
| Molecular Formula | C7H9ClO |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | cis-(1S,2S)-2-chloro-1-ethynylcyclopentan-1-ol |
| SMILES | C#C[C@@]1(O)CCC[C@@H]1Cl |
| InChI | InChI=1S/C7H9ClO/c1-2-7(9)5-3-4-6(7)8/h1,6,9H,3-5H2/t6-,7+/m0/s1 |
| InChIKey | CFZCYSWODMKACP-NKWVEPMBSA-N |
| XLogP | 1.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|