C12H19ClO — CID 134889581
cis-(1S,2S)-2-chloro-1-hex-1-ynylcyclohexan-1-ol (PubChem CID 134889581) has the molecular formula C12H19ClO and a molecular weight of 214.74 g/mol. Its IUPAC name is cis-(1S,2S)-2-chloro-1-hex-1-ynylcyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-chloro-1-hex-1-ynylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134889581 |
| Molecular Formula | C12H19ClO |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | cis-(1S,2S)-2-chloro-1-hex-1-ynylcyclohexan-1-ol |
| SMILES | CCCCC#C[C@@]1(O)CCCC[C@@H]1Cl |
| InChI | InChI=1S/C12H19ClO/c1-2-3-4-6-9-12(14)10-7-5-8-11(12)13/h11,14H,2-5,7-8,10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | XQUFLZXJJZXNEP-NWDGAFQWSA-N |
| XLogP | 3.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|