C20H32AuO — CID 87675243
gold;1-tetradeca-1,3-diynylcyclohexan-1-ol (PubChem CID 87675243) has the molecular formula C20H32AuO and a molecular weight of 485.44 g/mol. Its IUPAC name is gold;1-tetradeca-1,3-diynylcyclohexan-1-ol.
| Compound Name | gold;1-tetradeca-1,3-diynylcyclohexan-1-ol |
|---|---|
| PubChem CID | 87675243 |
| Molecular Formula | C20H32AuO |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | gold;1-tetradeca-1,3-diynylcyclohexan-1-ol |
| SMILES | CCCCCCCCCCC#CC#CC1(O)CCCCC1.[Au] |
| InChI | InChI=1S/C20H32O.Au/c1-2-3-4-5-6-7-8-9-10-11-12-14-17-20(21)18-15-13-16-19-20;/h21H,2-10,13,15-16,18-19H2,1H3; |
| InChIKey | XLCCPUCWXDRNFD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|