About henicosa-2,4-diynoate
henicosa-2,4-diynoate (PubChem CID 102596615) has the molecular formula C21H33O2-
and a molecular weight of 317.49 g/mol. Its IUPAC name is henicosa-2,4-diynoate.
Molecular Properties
| Compound Name | henicosa-2,4-diynoate |
| PubChem CID | 102596615 |
| Molecular Formula | C21H33O2- |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | henicosa-2,4-diynoate |
| SMILES | CCCCCCCCCCCCCCCCC#CC#CC(=O)[O-] |
| InChI | InChI=1S/C21H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23/h2-16H2,1H3,(H,22,23)/p-1 |
| InChIKey | FDAZNVBNBCCNHU-UHFFFAOYSA-M |
| XLogP | 4.61 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze henicosa-2,4-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicosa-2,4-diynoate?
The IUPAC name of henicosa-2,4-diynoate (CID 102596615) is henicosa-2,4-diynoate.
What is the SMILES notation for henicosa-2,4-diynoate?
The canonical SMILES for henicosa-2,4-diynoate is CCCCCCCCCCCCCCCCC#CC#CC(=O)[O-].
What is the InChIKey of henicosa-2,4-diynoate?
The InChIKey is FDAZNVBNBCCNHU-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23/h2-16H2,1H3,(H,22,23)/p-1.
What are the key properties of henicosa-2,4-diynoate?
henicosa-2,4-diynoate has a molecular weight of 317.49 g/mol, XLogP of 4.61, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for henicosa-2,4-diynoate is sourced from PubChem (CID 102596615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).